C12H14F4O2 — CID 174254528
2-tert-butyl-3-(1,1,2,2-tetrafluoroethoxy)phenol (PubChem CID 174254528) has the molecular formula C12H14F4O2 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-tert-butyl-3-(1,1,2,2-tetrafluoroethoxy)phenol.
| Compound Name | 2-tert-butyl-3-(1,1,2,2-tetrafluoroethoxy)phenol |
|---|---|
| PubChem CID | 174254528 |
| Molecular Formula | C12H14F4O2 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-tert-butyl-3-(1,1,2,2-tetrafluoroethoxy)phenol |
| SMILES | CC(C)(C)c1c(O)cccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C12H14F4O2/c1-11(2,3)9-7(17)5-4-6-8(9)18-12(15,16)10(13)14/h4-6,10,17H,1-3H3 |
| InChIKey | HVIQRZPCGHZWNN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|