C14H31N — CID 174258758
(5S)-3,11-dimethyldodecan-5-amine (PubChem CID 174258758) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is (5S)-3,11-dimethyldodecan-5-amine.
| Compound Name | (5S)-3,11-dimethyldodecan-5-amine |
|---|---|
| PubChem CID | 174258758 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | (5S)-3,11-dimethyldodecan-5-amine |
| SMILES | CCC(C)C[C@@H](N)CCCCCC(C)C |
| InChI | InChI=1S/C14H31N/c1-5-13(4)11-14(15)10-8-6-7-9-12(2)3/h12-14H,5-11,15H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | FVBCGSRGMCVPLY-KZUDCZAMSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|