C22H48N2 — CID 56622666
2,15,18-trimethylnonadecane-4,13-diamine (PubChem CID 56622666) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is 2,15,18-trimethylnonadecane-4,13-diamine.
| Compound Name | 2,15,18-trimethylnonadecane-4,13-diamine |
|---|---|
| PubChem CID | 56622666 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | 2,15,18-trimethylnonadecane-4,13-diamine |
| SMILES | CC(C)CCC(C)CC(N)CCCCCCCCC(N)CC(C)C |
| InChI | InChI=1S/C22H48N2/c1-18(2)14-15-20(5)17-22(24)13-11-9-7-6-8-10-12-21(23)16-19(3)4/h18-22H,6-17,23-24H2,1-5H3 |
| InChIKey | LORGPJUVQJVSGF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|