C15H23N — CID 174269518
3,3-dimethyl-N-(2-propylphenyl)butan-2-imine (PubChem CID 174269518) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 3,3-dimethyl-N-(2-propylphenyl)butan-2-imine.
| Compound Name | 3,3-dimethyl-N-(2-propylphenyl)butan-2-imine |
|---|---|
| PubChem CID | 174269518 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 3,3-dimethyl-N-(2-propylphenyl)butan-2-imine |
| SMILES | CCCc1ccccc1/N=C(\C)C(C)(C)C |
| InChI | InChI=1S/C15H23N/c1-6-9-13-10-7-8-11-14(13)16-12(2)15(3,4)5/h7-8,10-11H,6,9H2,1-5H3/b16-12+ |
| InChIKey | DLVXIVNZEUWWRF-FOWTUZBSSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|