C15H25N — CID 174284905
2-[(3E)-2,3-dimethylhexa-3,5-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 174284905) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-[(3E)-2,3-dimethylhexa-3,5-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[(3E)-2,3-dimethylhexa-3,5-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 174284905 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2-[(3E)-2,3-dimethylhexa-3,5-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | C=C/C=C(\C)C(C)CN1CC2CCCC2C1 |
| InChI | InChI=1S/C15H25N/c1-4-6-12(2)13(3)9-16-10-14-7-5-8-15(14)11-16/h4,6,13-15H,1,5,7-11H2,2-3H3/b12-6+ |
| InChIKey | XWRAYDFQXQVZOE-WUXMJOGZSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|