C28H48O3 — CID 174285754
(2,6,11,15-tetramethyl-9-oxohexadeca-2,7,14-trien-8-yl) octanoate (PubChem CID 174285754) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (2,6,11,15-tetramethyl-9-oxohexadeca-2,7,14-trien-8-yl) octanoate.
| Compound Name | (2,6,11,15-tetramethyl-9-oxohexadeca-2,7,14-trien-8-yl) octanoate |
|---|---|
| PubChem CID | 174285754 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (2,6,11,15-tetramethyl-9-oxohexadeca-2,7,14-trien-8-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC(=CC(C)CCC=C(C)C)C(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C28H48O3/c1-8-9-10-11-12-19-28(30)31-27(21-25(7)18-14-16-23(4)5)26(29)20-24(6)17-13-15-22(2)3/h15-16,21,24-25H,8-14,17-20H2,1-7H3 |
| InChIKey | VCYNDELRRJGUOV-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|