About S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate
S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate (PubChem CID 174291887) has the molecular formula C18H13NOS
and a molecular weight of 291.38 g/mol. Its IUPAC name is S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate.
Molecular Properties
| Compound Name | S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate |
| PubChem CID | 174291887 |
| Molecular Formula | C18H13NOS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate |
| SMILES | C#Cc1ccc(SC(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C18H13NOS/c1-2-13-7-9-15(10-8-13)21-18(20)11-14-12-19-17-6-4-3-5-16(14)17/h1,3-10,12,19H,11H2 |
| InChIKey | CXSVAASKRVWCFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate?
The IUPAC name of S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate (CID 174291887) is S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate.
What is the SMILES notation for S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate?
The canonical SMILES for S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate is C#Cc1ccc(SC(=O)Cc2c[nH]c3ccccc23)cc1.
What is the InChIKey of S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate?
The InChIKey is CXSVAASKRVWCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NOS/c1-2-13-7-9-15(10-8-13)21-18(20)11-14-12-19-17-6-4-3-5-16(14)17/h1,3-10,12,19H,11H2.
What are the key properties of S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate?
S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate has a molecular weight of 291.38 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-ethynylphenyl) 2-(1H-indol-3-yl)ethanethioate is sourced from PubChem (CID 174291887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).