About 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane
2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174295370) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 174295370 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C=Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C9H8O2.C6H10O3/c1-2-7-5-3-4-6-8(7)9(10)11;1(5-3-8-5)7-2-6-4-9-6/h2-6H,1H2,(H,10,11);5-6H,1-4H2 |
| InChIKey | JMNNFVHTAVZCSO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 174295370) is 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.C=Cc1ccccc1C(=O)O.
What is the InChIKey of 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is JMNNFVHTAVZCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C6H10O3/c1-2-7-5-3-4-6-8(7)9(10)11;1(5-3-8-5)7-2-6-4-9-6/h2-6H,1H2,(H,10,11);5-6H,1-4H2.
What are the key properties of 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane?
2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 278.30 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbenzoic acid;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 174295370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).