C17H24N2O2 — CID 174295946
(2E,4E,6E,7Z)-5-ethyl-2-methyl-9-methylidene-6-propylidenedeca-2,4,7-trienediamide (PubChem CID 174295946) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2E,4E,6E,7Z)-5-ethyl-2-methyl-9-methylidene-6-propylidenedeca-2,4,7-trienediamide.
| Compound Name | (2E,4E,6E,7Z)-5-ethyl-2-methyl-9-methylidene-6-propylidenedeca-2,4,7-trienediamide |
|---|---|
| PubChem CID | 174295946 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2E,4E,6E,7Z)-5-ethyl-2-methyl-9-methylidene-6-propylidenedeca-2,4,7-trienediamide |
| SMILES | C=C(/C=C\C(=C/CC)\C(=C\C=C(/C)C(N)=O)CC)C(N)=O |
| InChI | InChI=1S/C17H24N2O2/c1-5-7-15(11-9-13(4)17(19)21)14(6-2)10-8-12(3)16(18)20/h7-11H,4-6H2,1-3H3,(H2,18,20)(H2,19,21)/b11-9-,12-8+,14-10+,15-7+ |
| InChIKey | WVSRUTDKIJHULL-RANCXDPVSA-N |
| XLogP | 2.69 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|