C51H45ClN4O4 — CID 174301236
2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-methylbenzoyl]-8-chloro-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid;1H-1,5-benzodiazepine (PubChem CID 174301236) has the molecular formula C51H45ClN4O4 and a molecular weight of 813.40 g/mol. Its IUPAC name is 2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-methylbenzoyl]-8-chloro-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid;1H-1,5-benzodiazepine.
| Compound Name | 2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-methylbenzoyl]-8-chloro-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid;1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 174301236 |
| Molecular Formula | C51H45ClN4O4 |
| Molecular Weight | 813.40 g/mol |
| Exact Mass | 812.31 |
| IUPAC Name | 2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-methylbenzoyl]-8-chloro-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid;1H-1,5-benzodiazepine |
| SMILES | C1=CNc2ccccc2N=C1.Cc1cc(C(=O)C2Cc3cc(Cl)ccc3-c3ccc4c(c32)CCCC4CC(=O)O)ccc1NC(=O)c1ccccc1-c1ccc(CN)cc1 |
| InChI | InChI=1S/C42H37ClN2O4.C9H8N2/c1-24-19-28(13-18-38(24)45-42(49)36-7-3-2-6-31(36)26-11-9-25(23-44)10-12-26)41(48)37-21-29-20-30(43)14-15-33(29)35-17-16-32-27(22-39(46)47)5-4-8-34(32)40(35)37;1-2-5-9-8(4-1)10-6-3-7-11-9/h2-3,6-7,9-20,27,37H,4-5,8,21-23,44H2,1H3,(H,45,49)(H,46,47);1-7,10H |
| InChIKey | RFIBHZFICYHHCN-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.40 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |