C41H36N2O5 — CID 174413970
2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-hydroxybenzoyl]-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid (PubChem CID 174413970) has the molecular formula C41H36N2O5 and a molecular weight of 636.75 g/mol. Its IUPAC name is 2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-hydroxybenzoyl]-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid.
| Compound Name | 2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-hydroxybenzoyl]-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid |
|---|---|
| PubChem CID | 174413970 |
| Molecular Formula | C41H36N2O5 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | 2-[5-[4-[[2-[4-(aminomethyl)phenyl]benzoyl]amino]-3-hydroxybenzoyl]-1,2,3,4,5,6-hexahydrochrysen-1-yl]acetic acid |
| SMILES | NCc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)C3Cc4ccccc4-c4ccc5c(c43)CCCC5CC(=O)O)cc2O)cc1 |
| InChI | InChI=1S/C41H36N2O5/c42-23-24-12-14-25(15-13-24)29-8-3-4-10-34(29)41(48)43-36-19-16-28(21-37(36)44)40(47)35-20-26-6-1-2-9-30(26)33-18-17-31-27(22-38(45)46)7-5-11-32(31)39(33)35/h1-4,6,8-10,12-19,21,27,35,44H,5,7,11,20,22-23,42H2,(H,43,48)(H,45,46) |
| InChIKey | VSHYFHWYNKJJOF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|