C44H45N3O2 — CID 174310594
2-[4-(aminomethyl)phenyl]-N-[4-[1-[3-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide (PubChem CID 174310594) has the molecular formula C44H45N3O2 and a molecular weight of 647.86 g/mol. Its IUPAC name is 2-[4-(aminomethyl)phenyl]-N-[4-[1-[3-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide.
| Compound Name | 2-[4-(aminomethyl)phenyl]-N-[4-[1-[3-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 174310594 |
| Molecular Formula | C44H45N3O2 |
| Molecular Weight | 647.86 g/mol |
| Exact Mass | 647.35 |
| IUPAC Name | 2-[4-(aminomethyl)phenyl]-N-[4-[1-[3-(dimethylamino)propyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide |
| SMILES | CN(C)CCCC1CCCc2c1ccc1c2C(C(=O)c2ccc(NC(=O)c3ccccc3-c3ccc(CN)cc3)cc2)Cc2ccccc2-1 |
| InChI | InChI=1S/C44H45N3O2/c1-47(2)26-8-11-30-10-7-15-38-37(30)24-25-39-36-13-4-3-9-33(36)27-41(42(38)39)43(48)32-20-22-34(23-21-32)46-44(49)40-14-6-5-12-35(40)31-18-16-29(28-45)17-19-31/h3-6,9,12-14,16-25,30,41H,7-8,10-11,15,26-28,45H2,1-2H3,(H,46,49) |
| InChIKey | KWXBNMUPQBAZKC-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.86 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |