C54H55N5O2 — CID 174352414
2-[2-(aminomethyl)phenyl]-N-[4-[1-[4-(dimethylamino)butyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide;1H-1,5-benzodiazepine (PubChem CID 174352414) has the molecular formula C54H55N5O2 and a molecular weight of 806.07 g/mol. Its IUPAC name is 2-[2-(aminomethyl)phenyl]-N-[4-[1-[4-(dimethylamino)butyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide;1H-1,5-benzodiazepine.
| Compound Name | 2-[2-(aminomethyl)phenyl]-N-[4-[1-[4-(dimethylamino)butyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide;1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 174352414 |
| Molecular Formula | C54H55N5O2 |
| Molecular Weight | 806.07 g/mol |
| Exact Mass | 805.44 |
| IUPAC Name | 2-[2-(aminomethyl)phenyl]-N-[4-[1-[4-(dimethylamino)butyl]-1,2,3,4,5,6-hexahydrochrysene-5-carbonyl]phenyl]benzamide;1H-1,5-benzodiazepine |
| SMILES | C1=CNc2ccccc2N=C1.CN(C)CCCCC1CCCc2c1ccc1c2C(C(=O)c2ccc(NC(=O)c3ccccc3-c3ccccc3CN)cc2)Cc2ccccc2-1 |
| InChI | InChI=1S/C45H47N3O2.C9H8N2/c1-48(2)27-10-9-12-30-15-11-20-39-37(30)25-26-40-35-16-5-3-13-32(35)28-42(43(39)40)44(49)31-21-23-34(24-22-31)47-45(50)41-19-8-7-18-38(41)36-17-6-4-14-33(36)29-46;1-2-5-9-8(4-1)10-6-3-7-11-9/h3-8,13-14,16-19,21-26,30,42H,9-12,15,20,27-29,46H2,1-2H3,(H,47,50);1-7,10H |
| InChIKey | LIRYTBCCKYOGEM-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.07 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|