C26H25O5P — CID 174310786
1,2-diphenylethenylbenzene;phenol;phosphoric acid (PubChem CID 174310786) has the molecular formula C26H25O5P and a molecular weight of 448.46 g/mol. Its IUPAC name is 1,2-diphenylethenylbenzene;phenol;phosphoric acid.
| Compound Name | 1,2-diphenylethenylbenzene;phenol;phosphoric acid |
|---|---|
| PubChem CID | 174310786 |
| Molecular Formula | C26H25O5P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1,2-diphenylethenylbenzene;phenol;phosphoric acid |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1.O=P(O)(O)O.Oc1ccccc1 |
| InChI | InChI=1S/C20H16.C6H6O.H3O4P/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-16H;1-5,7H;(H3,1,2,3,4) |
| InChIKey | GXOMKNHAYQTUFH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|