C33H52N2O10 — CID 174321880
2-[2-[2-[2-[4-[2-[2-[[(4S,7E)-7-hydroxy-9-oxo-8-(2,4,6-trimethylphenyl)-3,4,5,6-tetrahydro-2H-oxonin-4-yl]oxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 174321880) has the molecular formula C33H52N2O10 and a molecular weight of 636.78 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[2-[2-[[(4S,7E)-7-hydroxy-9-oxo-8-(2,4,6-trimethylphenyl)-3,4,5,6-tetrahydro-2H-oxonin-4-yl]oxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[4-[2-[2-[[(4S,7E)-7-hydroxy-9-oxo-8-(2,4,6-trimethylphenyl)-3,4,5,6-tetrahydro-2H-oxonin-4-yl]oxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 174321880 |
| Molecular Formula | C33H52N2O10 |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | 2-[2-[2-[2-[4-[2-[2-[[(4S,7E)-7-hydroxy-9-oxo-8-(2,4,6-trimethylphenyl)-3,4,5,6-tetrahydro-2H-oxonin-4-yl]oxy]ethoxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | Cc1cc(C)c(/C2=C(\O)CC[C@H](OCCOCCN3CCN(CCOCCOCCOCC(=O)O)CC3)CCOC2=O)c(C)c1 |
| InChI | InChI=1S/C33H52N2O10/c1-25-22-26(2)31(27(3)23-25)32-29(36)5-4-28(6-13-45-33(32)39)44-21-20-41-15-12-35-9-7-34(8-10-35)11-14-40-16-17-42-18-19-43-24-30(37)38/h22-23,28,36H,4-21,24H2,1-3H3,(H,37,38)/b32-29+/t28-/m0/s1 |
| InChIKey | RNFALFCLEVZJEG-KLZLXOCPSA-N |
| XLogP | 2.76 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|