C16H22BrN3O5 — CID 174334356
2-O-(5-amino-2-bromo-6-methoxy-3-pyridinyl) 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate (PubChem CID 174334356) has the molecular formula C16H22BrN3O5 and a molecular weight of 416.27 g/mol. Its IUPAC name is 2-O-(5-amino-2-bromo-6-methoxy-3-pyridinyl) 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-(5-amino-2-bromo-6-methoxy-3-pyridinyl) 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174334356 |
| Molecular Formula | C16H22BrN3O5 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-O-(5-amino-2-bromo-6-methoxy-3-pyridinyl) 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate |
| SMILES | COc1nc(Br)c(OC(=O)[C@H]2CCCN2C(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C16H22BrN3O5/c1-16(2,3)25-15(22)20-7-5-6-10(20)14(21)24-11-8-9(18)13(23-4)19-12(11)17/h8,10H,5-7,18H2,1-4H3/t10-/m1/s1 |
| InChIKey | LUJDTMOUYGEFDW-SNVBAGLBSA-N |
| XLogP | 2.74 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|