C25H26N4O4 — CID 17434795
3-benzyl-7-butyl-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)purine-2,6-dione (PubChem CID 17434795) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-benzyl-7-butyl-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)purine-2,6-dione.
| Compound Name | 3-benzyl-7-butyl-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 17434795 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-benzyl-7-butyl-1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)purine-2,6-dione |
| SMILES | CCCCn1cnc2c1c(=O)n(CC1COc3ccccc3O1)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H26N4O4/c1-2-3-13-27-17-26-23-22(27)24(30)29(25(31)28(23)14-18-9-5-4-6-10-18)15-19-16-32-20-11-7-8-12-21(20)33-19/h4-12,17,19H,2-3,13-16H2,1H3 |
| InChIKey | PZNSUFFTNBBWRM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |