About (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate
(4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate (PubChem CID 174348041) has the molecular formula C15H19IO5
and a molecular weight of 406.22 g/mol. Its IUPAC name is (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate.
Molecular Properties
| Compound Name | (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate |
| PubChem CID | 174348041 |
| Molecular Formula | C15H19IO5 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate |
| SMILES | C=Cc1cc(I)c(OC(=O)OC(C)OCCC)c(OC)c1 |
| InChI | InChI=1S/C15H19IO5/c1-5-7-19-10(3)20-15(17)21-14-12(16)8-11(6-2)9-13(14)18-4/h6,8-10H,2,5,7H2,1,3-4H3 |
| InChIKey | ZEAUXHUYTXFWCW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate?
The IUPAC name of (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate (CID 174348041) is (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate.
What is the SMILES notation for (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate?
The canonical SMILES for (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate is C=Cc1cc(I)c(OC(=O)OC(C)OCCC)c(OC)c1.
What is the InChIKey of (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate?
The InChIKey is ZEAUXHUYTXFWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19IO5/c1-5-7-19-10(3)20-15(17)21-14-12(16)8-11(6-2)9-13(14)18-4/h6,8-10H,2,5,7H2,1,3-4H3.
What are the key properties of (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate?
(4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate has a molecular weight of 406.22 g/mol, XLogP of 4.23, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenyl-2-iodo-6-methoxyphenyl) 1-propoxyethyl carbonate is sourced from PubChem (CID 174348041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).