C25H28N4O2 — CID 174361144
tert-butyl N-[(3R)-1-[2-(4-cyanophenyl)indolizin-8-yl]piperidin-3-yl]carbamate (PubChem CID 174361144) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-(4-cyanophenyl)indolizin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-(4-cyanophenyl)indolizin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 174361144 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-(4-cyanophenyl)indolizin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(c2cccn3cc(-c4ccc(C#N)cc4)cc23)C1 |
| InChI | InChI=1S/C25H28N4O2/c1-25(2,3)31-24(30)27-21-6-4-12-29(17-21)22-7-5-13-28-16-20(14-23(22)28)19-10-8-18(15-26)9-11-19/h5,7-11,13-14,16,21H,4,6,12,17H2,1-3H3,(H,27,30)/t21-/m1/s1 |
| InChIKey | DTOGAOQRNNSVBU-OAQYLSRUSA-N |
| XLogP | 4.97 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |