About phenylbenzene;titanium
phenylbenzene;titanium (PubChem CID 174362051) has the molecular formula C12H9Ti-
and a molecular weight of 201.07 g/mol. Its IUPAC name is phenylbenzene;titanium.
Molecular Properties
| Compound Name | phenylbenzene;titanium |
| PubChem CID | 174362051 |
| Molecular Formula | C12H9Ti- |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | phenylbenzene;titanium |
| SMILES | [Ti].[c-]1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9.Ti/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1,3-10H;/q-1; |
| InChIKey | DJEOTFOLOKIADY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze phenylbenzene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylbenzene;titanium?
The IUPAC name of phenylbenzene;titanium (CID 174362051) is phenylbenzene;titanium.
What is the SMILES notation for phenylbenzene;titanium?
The canonical SMILES for phenylbenzene;titanium is [Ti].[c-]1ccc(-c2ccccc2)cc1.
What is the InChIKey of phenylbenzene;titanium?
The InChIKey is DJEOTFOLOKIADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9.Ti/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1,3-10H;/q-1;.
What are the key properties of phenylbenzene;titanium?
phenylbenzene;titanium has a molecular weight of 201.07 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylbenzene;titanium is sourced from PubChem (CID 174362051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).