C26H50N6O3 — CID 174362490
6-[3-(dimethylamino)propyl-methylamino]-N-[3-[5-(2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl)pentanoylamino]propyl]hexanamide (PubChem CID 174362490) has the molecular formula C26H50N6O3 and a molecular weight of 494.73 g/mol. Its IUPAC name is 6-[3-(dimethylamino)propyl-methylamino]-N-[3-[5-(2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl)pentanoylamino]propyl]hexanamide.
| Compound Name | 6-[3-(dimethylamino)propyl-methylamino]-N-[3-[5-(2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl)pentanoylamino]propyl]hexanamide |
|---|---|
| PubChem CID | 174362490 |
| Molecular Formula | C26H50N6O3 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | 6-[3-(dimethylamino)propyl-methylamino]-N-[3-[5-(2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl)pentanoylamino]propyl]hexanamide |
| SMILES | CN(C)CCCN(C)CCCCCC(=O)NCCCNC(=O)CCCCC1CCC2NC(=O)NC12 |
| InChI | InChI=1S/C26H50N6O3/c1-31(2)18-10-20-32(3)19-8-4-5-12-23(33)27-16-9-17-28-24(34)13-7-6-11-21-14-15-22-25(21)30-26(35)29-22/h21-22,25H,4-20H2,1-3H3,(H,27,33)(H,28,34)(H2,29,30,35) |
| InChIKey | QJLLOFDOTWXEIX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|