C16H28N2O2 — CID 138644385
(3aR,4R,6aS)-4-(6-methyl-5-oxononyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-2-one (PubChem CID 138644385) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(6-methyl-5-oxononyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-2-one.
| Compound Name | (3aR,4R,6aS)-4-(6-methyl-5-oxononyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-2-one |
|---|---|
| PubChem CID | 138644385 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (3aR,4R,6aS)-4-(6-methyl-5-oxononyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-2-one |
| SMILES | CCCC(C)C(=O)CCCC[C@@H]1CC[C@@H]2NC(=O)N[C@H]12 |
| InChI | InChI=1S/C16H28N2O2/c1-3-6-11(2)14(19)8-5-4-7-12-9-10-13-15(12)18-16(20)17-13/h11-13,15H,3-10H2,1-2H3,(H2,17,18,20)/t11?,12-,13+,15-/m1/s1 |
| InChIKey | NZLFWVYWHKDKTM-VYHDIPPYSA-N |
| XLogP | 3.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|