C12H21N3O2 — CID 59847767
5-[(3aS,6aR)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl]-N-methylpentanamide (PubChem CID 59847767) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-[(3aS,6aR)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl]-N-methylpentanamide.
| Compound Name | 5-[(3aS,6aR)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl]-N-methylpentanamide |
|---|---|
| PubChem CID | 59847767 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 5-[(3aS,6aR)-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[d]imidazol-4-yl]-N-methylpentanamide |
| SMILES | CNC(=O)CCCCC1CC[C@H]2NC(=O)N[C@@H]12 |
| InChI | InChI=1S/C12H21N3O2/c1-13-10(16)5-3-2-4-8-6-7-9-11(8)15-12(17)14-9/h8-9,11H,2-7H2,1H3,(H,13,16)(H2,14,15,17)/t8?,9-,11+/m1/s1 |
| InChIKey | OYBMPKBLWYOJLV-SNZBGZMYSA-N |
| XLogP | 0.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|