C12H17N3 — CID 174363075
(2E,4Z)-3-(1-cyanoethyl)-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide (PubChem CID 174363075) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is (2E,4Z)-3-(1-cyanoethyl)-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-3-(1-cyanoethyl)-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 174363075 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (2E,4Z)-3-(1-cyanoethyl)-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide |
| SMILES | C/C=C\N=C(N)\C=C(/C=C\C)C(C)C#N |
| InChI | InChI=1S/C12H17N3/c1-4-6-11(10(3)9-13)8-12(14)15-7-5-2/h4-8,10H,1-3H3,(H2,14,15)/b6-4-,7-5-,11-8+ |
| InChIKey | OCSAUAZYMKZDKZ-SSIOXZPMSA-N |
| XLogP | 2.54 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|