C14H29N3O2 — CID 174363523
2,2,6-tris(methylamino)-4-(2-methylpropyl)heptane-3,5-dione (PubChem CID 174363523) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2,2,6-tris(methylamino)-4-(2-methylpropyl)heptane-3,5-dione.
| Compound Name | 2,2,6-tris(methylamino)-4-(2-methylpropyl)heptane-3,5-dione |
|---|---|
| PubChem CID | 174363523 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2,2,6-tris(methylamino)-4-(2-methylpropyl)heptane-3,5-dione |
| SMILES | CNC(C)C(=O)C(CC(C)C)C(=O)C(C)(NC)NC |
| InChI | InChI=1S/C14H29N3O2/c1-9(2)8-11(12(18)10(3)15-5)13(19)14(4,16-6)17-7/h9-11,15-17H,8H2,1-7H3 |
| InChIKey | AHSPMHJHRUZKEO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|