C29H26N2O5S — CID 174366439
1-benzoxepine;N-(7-nitro-2,3,4,5-tetrahydrochrysen-5-yl)methanesulfonamide (PubChem CID 174366439) has the molecular formula C29H26N2O5S and a molecular weight of 514.60 g/mol. Its IUPAC name is 1-benzoxepine;N-(7-nitro-2,3,4,5-tetrahydrochrysen-5-yl)methanesulfonamide.
| Compound Name | 1-benzoxepine;N-(7-nitro-2,3,4,5-tetrahydrochrysen-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 174366439 |
| Molecular Formula | C29H26N2O5S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 1-benzoxepine;N-(7-nitro-2,3,4,5-tetrahydrochrysen-5-yl)methanesulfonamide |
| SMILES | C1=COc2ccccc2C=C1.CS(=O)(=O)NC1C=c2c([N+](=O)[O-])cccc2=c2ccc3c(c21)CCCC=3 |
| InChI | InChI=1S/C19H18N2O4S.C10H8O/c1-26(24,25)20-17-11-16-14(7-4-8-18(16)21(22)23)15-10-9-12-5-2-3-6-13(12)19(15)17;1-2-7-10-9(5-1)6-3-4-8-11-10/h4-5,7-11,17,20H,2-3,6H2,1H3;1-8H |
| InChIKey | KJICLORYSDACME-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|