C18H13NO3 — CID 174390724
4-nitro-19-oxapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-2,4,6,8,10,12,17-heptaene (PubChem CID 174390724) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-nitro-19-oxapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-2,4,6,8,10,12,17-heptaene.
| Compound Name | 4-nitro-19-oxapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-2,4,6,8,10,12,17-heptaene |
|---|---|
| PubChem CID | 174390724 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-nitro-19-oxapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-2,4,6,8,10,12,17-heptaene |
| SMILES | O=[N+]([O-])c1cccc2c1=CC1OC3CCC=c4ccc=2c1c43 |
| InChI | InChI=1S/C18H13NO3/c20-19(21)14-5-2-4-11-12-8-7-10-3-1-6-15-17(10)18(12)16(22-15)9-13(11)14/h2-5,7-9,15-16H,1,6H2 |
| InChIKey | GGGNGDJPAQJASG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|