About 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile
2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile (PubChem CID 174368817) has the molecular formula C23H15N2P
and a molecular weight of 350.36 g/mol. Its IUPAC name is 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile |
| PubChem CID | 174368817 |
| Molecular Formula | C23H15N2P |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(C#P(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H15N2P/c24-16-20(17-25)23(19-10-4-1-5-11-19)18-26(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15H |
| InChIKey | HGJQGIYGBQVTOT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile?
The IUPAC name of 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile (CID 174368817) is 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile.
What is the SMILES notation for 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile?
The canonical SMILES for 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile is N#CC(C#N)=C(C#P(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile?
The InChIKey is HGJQGIYGBQVTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N2P/c24-16-20(17-25)23(19-10-4-1-5-11-19)18-26(21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15H.
What are the key properties of 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile?
2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile has a molecular weight of 350.36 g/mol, XLogP of 4.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diphenyl-λ5-phosphanylidyne)-1-phenylethylidene]propanedinitrile is sourced from PubChem (CID 174368817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).