C36H38N2O4 — CID 174372825
3-[benzyl-(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-2-(3-nitro-4-phenylmethoxyphenyl)propanal (PubChem CID 174372825) has the molecular formula C36H38N2O4 and a molecular weight of 562.71 g/mol. Its IUPAC name is 3-[benzyl-(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-2-(3-nitro-4-phenylmethoxyphenyl)propanal.
| Compound Name | 3-[benzyl-(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-2-(3-nitro-4-phenylmethoxyphenyl)propanal |
|---|---|
| PubChem CID | 174372825 |
| Molecular Formula | C36H38N2O4 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 3-[benzyl-(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-2-(3-nitro-4-phenylmethoxyphenyl)propanal |
| SMILES | CCc1cc2c(cc1CC)CC(N(Cc1ccccc1)CC(C=O)c1ccc(OCc3ccccc3)c([N+](=O)[O-])c1)C2 |
| InChI | InChI=1S/C36H38N2O4/c1-3-28-17-31-19-34(20-32(31)18-29(28)4-2)37(22-26-11-7-5-8-12-26)23-33(24-39)30-15-16-36(35(21-30)38(40)41)42-25-27-13-9-6-10-14-27/h5-18,21,24,33-34H,3-4,19-20,22-23,25H2,1-2H3 |
| InChIKey | WOXVJHPHUGKZJR-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|