C18H16N4O3S — CID 174379384
[4-amino-2-(N-ethylanilino)-1,3-thiazol-5-yl]-(2-nitrophenyl)methanone (PubChem CID 174379384) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is [4-amino-2-(N-ethylanilino)-1,3-thiazol-5-yl]-(2-nitrophenyl)methanone.
| Compound Name | [4-amino-2-(N-ethylanilino)-1,3-thiazol-5-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 174379384 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [4-amino-2-(N-ethylanilino)-1,3-thiazol-5-yl]-(2-nitrophenyl)methanone |
| SMILES | CCN(c1ccccc1)c1nc(N)c(C(=O)c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C18H16N4O3S/c1-2-21(12-8-4-3-5-9-12)18-20-17(19)16(26-18)15(23)13-10-6-7-11-14(13)22(24)25/h3-11H,2,19H2,1H3 |
| InChIKey | VSEOXZJEXWFLDU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|