C40H41ClN2O4 — CID 174387337
[1-[[3-(1,2,3,4-tetrahydrochrysen-2-yl)furan-2-yl]methyl]piperidin-4-yl] 5-amino-6-chloro-2,2-dimethyl-3,4-dihydrochromene-8-carboxylate (PubChem CID 174387337) has the molecular formula C40H41ClN2O4 and a molecular weight of 649.23 g/mol. Its IUPAC name is [1-[[3-(1,2,3,4-tetrahydrochrysen-2-yl)furan-2-yl]methyl]piperidin-4-yl] 5-amino-6-chloro-2,2-dimethyl-3,4-dihydrochromene-8-carboxylate.
| Compound Name | [1-[[3-(1,2,3,4-tetrahydrochrysen-2-yl)furan-2-yl]methyl]piperidin-4-yl] 5-amino-6-chloro-2,2-dimethyl-3,4-dihydrochromene-8-carboxylate |
|---|---|
| PubChem CID | 174387337 |
| Molecular Formula | C40H41ClN2O4 |
| Molecular Weight | 649.23 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | [1-[[3-(1,2,3,4-tetrahydrochrysen-2-yl)furan-2-yl]methyl]piperidin-4-yl] 5-amino-6-chloro-2,2-dimethyl-3,4-dihydrochromene-8-carboxylate |
| SMILES | CC1(C)CCc2c(N)c(Cl)cc(C(=O)OC3CCN(Cc4occc4C4CCc5c(ccc6c5ccc5ccccc56)C4)CC3)c2O1 |
| InChI | InChI=1S/C40H41ClN2O4/c1-40(2)17-13-33-37(42)35(41)22-34(38(33)47-40)39(44)46-27-14-18-43(19-15-27)23-36-30(16-20-45-36)26-8-10-29-25(21-26)9-12-31-28-6-4-3-5-24(28)7-11-32(29)31/h3-7,9,11-12,16,20,22,26-27H,8,10,13-15,17-19,21,23,42H2,1-2H3 |
| InChIKey | VLWQGQXNBQIRRU-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.23 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|