C29H22N2O4 — CID 174388833
methyl 3-(7-nitro-1,2,3,4-tetrahydrochrysen-3-yl)isoquinoline-1-carboxylate (PubChem CID 174388833) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is methyl 3-(7-nitro-1,2,3,4-tetrahydrochrysen-3-yl)isoquinoline-1-carboxylate.
| Compound Name | methyl 3-(7-nitro-1,2,3,4-tetrahydrochrysen-3-yl)isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 174388833 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | methyl 3-(7-nitro-1,2,3,4-tetrahydrochrysen-3-yl)isoquinoline-1-carboxylate |
| SMILES | COC(=O)c1nc(C2CCc3ccc4c(ccc5c([N+](=O)[O-])cccc54)c3C2)cc2ccccc12 |
| InChI | InChI=1S/C29H22N2O4/c1-35-29(32)28-20-6-3-2-5-18(20)16-26(30-28)19-10-9-17-11-12-22-21-7-4-8-27(31(33)34)24(21)14-13-23(22)25(17)15-19/h2-8,11-14,16,19H,9-10,15H2,1H3 |
| InChIKey | RGZAFJIRGJPTHJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|