C24H18FNO3 — CID 174680720
(3S)-3-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydrochrysene (PubChem CID 174680720) has the molecular formula C24H18FNO3 and a molecular weight of 387.41 g/mol. Its IUPAC name is (3S)-3-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydrochrysene.
| Compound Name | (3S)-3-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174680720 |
| Molecular Formula | C24H18FNO3 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (3S)-3-(5-fluoro-2-nitrophenoxy)-1,2,3,4-tetrahydrochrysene |
| SMILES | O=[N+]([O-])c1ccc(F)cc1O[C@H]1CCc2ccc3c(ccc4ccccc43)c2C1 |
| InChI | InChI=1S/C24H18FNO3/c25-17-8-12-23(26(27)28)24(13-17)29-18-9-5-16-7-10-20-19-4-2-1-3-15(19)6-11-21(20)22(16)14-18/h1-4,6-8,10-13,18H,5,9,14H2/t18-/m0/s1 |
| InChIKey | MIYWFWIWDJOZOG-SFHVURJKSA-N |
| XLogP | 5.98 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|