C12H20NO6PSi — CID 174390406
[1-hydroxy-1-(3-nitrophenyl)-3-trimethylsilylpropyl]phosphonic acid (PubChem CID 174390406) has the molecular formula C12H20NO6PSi and a molecular weight of 333.35 g/mol. Its IUPAC name is [1-hydroxy-1-(3-nitrophenyl)-3-trimethylsilylpropyl]phosphonic acid.
| Compound Name | [1-hydroxy-1-(3-nitrophenyl)-3-trimethylsilylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 174390406 |
| Molecular Formula | C12H20NO6PSi |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [1-hydroxy-1-(3-nitrophenyl)-3-trimethylsilylpropyl]phosphonic acid |
| SMILES | C[Si](C)(C)CCC(O)(c1cccc([N+](=O)[O-])c1)P(=O)(O)O |
| InChI | InChI=1S/C12H20NO6PSi/c1-21(2,3)8-7-12(14,20(17,18)19)10-5-4-6-11(9-10)13(15)16/h4-6,9,14H,7-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | QJZJOMPKVNGGAP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|