C22H21F2N3O4S — CID 174395543
4-[5-[5-(1,3-benzodioxol-5-yl)pent-1-enyl]-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 174395543) has the molecular formula C22H21F2N3O4S and a molecular weight of 461.49 g/mol. Its IUPAC name is 4-[5-[5-(1,3-benzodioxol-5-yl)pent-1-enyl]-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-[5-(1,3-benzodioxol-5-yl)pent-1-enyl]-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 174395543 |
| Molecular Formula | C22H21F2N3O4S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[5-[5-(1,3-benzodioxol-5-yl)pent-1-enyl]-3-(difluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)F)cc2C=CCCCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H21F2N3O4S/c23-22(24)19-13-17(27(26-19)16-7-9-18(10-8-16)32(25,28)29)5-3-1-2-4-15-6-11-20-21(12-15)31-14-30-20/h3,5-13,22H,1-2,4,14H2,(H2,25,28,29) |
| InChIKey | BGRHFOLJLYUSPV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|