C17H14N2O2S — CID 174395896
N-(2-methyl-5-pyridin-3-ylthiophen-3-yl)-1,3-benzodioxol-5-amine (PubChem CID 174395896) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(2-methyl-5-pyridin-3-ylthiophen-3-yl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(2-methyl-5-pyridin-3-ylthiophen-3-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 174395896 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(2-methyl-5-pyridin-3-ylthiophen-3-yl)-1,3-benzodioxol-5-amine |
| SMILES | Cc1sc(-c2cccnc2)cc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N2O2S/c1-11-14(8-17(22-11)12-3-2-6-18-9-12)19-13-4-5-15-16(7-13)21-10-20-15/h2-9,19H,10H2,1H3 |
| InChIKey | NJBWVXOMWZRUEW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |