C21H15N5O2S — CID 77107445
N-[(E)-[6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2-pyridinyl]methylideneamino]-1,3-benzodioxol-5-amine (PubChem CID 77107445) has the molecular formula C21H15N5O2S and a molecular weight of 401.45 g/mol. Its IUPAC name is N-[(E)-[6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2-pyridinyl]methylideneamino]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(E)-[6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2-pyridinyl]methylideneamino]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 77107445 |
| Molecular Formula | C21H15N5O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(E)-[6-(2-pyridin-3-yl-1,3-thiazol-5-yl)-2-pyridinyl]methylideneamino]-1,3-benzodioxol-5-amine |
| SMILES | C(=N/Nc1ccc2c(c1)OCO2)\c1cccc(-c2cnc(-c3cccnc3)s2)n1 |
| InChI | InChI=1S/C21H15N5O2S/c1-4-16(11-24-26-15-6-7-18-19(9-15)28-13-27-18)25-17(5-1)20-12-23-21(29-20)14-3-2-8-22-10-14/h1-12,26H,13H2/b24-11+ |
| InChIKey | YWHZQTASYXKDBA-BHGWPJFGSA-N |
| XLogP | 4.44 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|