C9H20O5Si — CID 174398843
[2,3,3-trimethoxy-3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 174398843) has the molecular formula C9H20O5Si and a molecular weight of 236.34 g/mol. Its IUPAC name is [2,3,3-trimethoxy-3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | [2,3,3-trimethoxy-3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 174398843 |
| Molecular Formula | C9H20O5Si |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | [2,3,3-trimethoxy-3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | COC(C[SiH3])C(OC)(OC)OCC1CO1 |
| InChI | InChI=1S/C9H20O5Si/c1-10-8(6-15)9(11-2,12-3)14-5-7-4-13-7/h7-8H,4-6H2,1-3,15H3 |
| InChIKey | TXSOUFXWPLHEAP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|