C9H17NO7 — CID 174405460
3-aminopropanoic acid;3-formyl-2,4-dihydroxy-3-methylbutanoic acid (PubChem CID 174405460) has the molecular formula C9H17NO7 and a molecular weight of 251.23 g/mol. Its IUPAC name is 3-aminopropanoic acid;3-formyl-2,4-dihydroxy-3-methylbutanoic acid.
| Compound Name | 3-aminopropanoic acid;3-formyl-2,4-dihydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 174405460 |
| Molecular Formula | C9H17NO7 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-aminopropanoic acid;3-formyl-2,4-dihydroxy-3-methylbutanoic acid |
| SMILES | CC(C=O)(CO)C(O)C(=O)O.NCCC(=O)O |
| InChI | InChI=1S/C6H10O5.C3H7NO2/c1-6(2-7,3-8)4(9)5(10)11;4-2-1-3(5)6/h2,4,8-9H,3H2,1H3,(H,10,11);1-2,4H2,(H,5,6) |
| InChIKey | PUGMLPPYFLDIAV-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|