C7H14N2O6 — CID 89158281
(2S)-2-aminobutanedioic acid;3-aminopropanoic acid (PubChem CID 89158281) has the molecular formula C7H14N2O6 and a molecular weight of 222.20 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;3-aminopropanoic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;3-aminopropanoic acid |
|---|---|
| PubChem CID | 89158281 |
| Molecular Formula | C7H14N2O6 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;3-aminopropanoic acid |
| SMILES | NCCC(=O)O.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4.C3H7NO2/c5-2(4(8)9)1-3(6)7;4-2-1-3(5)6/h2H,1,5H2,(H,6,7)(H,8,9);1-2,4H2,(H,5,6)/t2-;/m0./s1 |
| InChIKey | KFGMDFVFAVPYKT-DKWTVANSSA-N |
| XLogP | -1.71 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |