C12H14ClN3O2S — CID 174406282
3-(1-chlorocyclopentyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine (PubChem CID 174406282) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-(1-chlorocyclopentyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine.
| Compound Name | 3-(1-chlorocyclopentyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine |
|---|---|
| PubChem CID | 174406282 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-(1-chlorocyclopentyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-4-amine |
| SMILES | NN1C(C2(Cl)CCCC2)=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C12H14ClN3O2S/c13-12(7-3-4-8-12)11-15-19(17,18)10-6-2-1-5-9(10)16(11)14/h1-2,5-6H,3-4,7-8,14H2 |
| InChIKey | IXWVBWMUIIPVPO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|