C12H12N2O2S — CID 67427206
8λ6-thia-1,9-diazatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6,9-tetraene 8,8-dioxide (PubChem CID 67427206) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 8λ6-thia-1,9-diazatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6,9-tetraene 8,8-dioxide.
| Compound Name | 8λ6-thia-1,9-diazatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6,9-tetraene 8,8-dioxide |
|---|---|
| PubChem CID | 67427206 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 8λ6-thia-1,9-diazatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6,9-tetraene 8,8-dioxide |
| SMILES | O=S1(=O)N=C2C3CCCC3N2c2ccccc21 |
| InChI | InChI=1S/C12H12N2O2S/c15-17(16)11-7-2-1-5-10(11)14-9-6-3-4-8(9)12(14)13-17/h1-2,5,7-9H,3-4,6H2 |
| InChIKey | BHNLJRLEFIZERA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |