C12H14O8 — CID 174415814
2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 174415814) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 174415814 |
| Molecular Formula | C12H14O8 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C([C@@]2(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)=C1 |
| InChI | InChI=1S/C12H14O8/c13-4-8-9(16)10(17)11(18)12(19,20-8)6-3-5(14)1-2-7(6)15/h1-3,8-11,13,16-19H,4H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | OTGZOGRMXKXZKL-YBXAARCKSA-N |
| XLogP | -3.22 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|