C8H13N3O5 — CID 174423377
(1S,2R,4S,5S)-2-azido-4-(hydroxymethyl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol (PubChem CID 174423377) has the molecular formula C8H13N3O5 and a molecular weight of 231.21 g/mol. Its IUPAC name is (1S,2R,4S,5S)-2-azido-4-(hydroxymethyl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol.
| Compound Name | (1S,2R,4S,5S)-2-azido-4-(hydroxymethyl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol |
|---|---|
| PubChem CID | 174423377 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (1S,2R,4S,5S)-2-azido-4-(hydroxymethyl)-6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol |
| SMILES | CC1(C)[C@]2(O)[C@@]1(O)[C@H](CO)O[C@@]2(O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H13N3O5/c1-5(2)6(13)4(3-12)16-8(15,10-11-9)7(5,6)14/h4,12-15H,3H2,1-2H3/t4-,6+,7-,8+/m0/s1 |
| InChIKey | BAJHGSGRNQBHBN-VXUIKNBNSA-N |
| XLogP | -1.16 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|