About 1H-azepine;stilbene
1H-azepine;stilbene (PubChem CID 174433083) has the molecular formula C20H19N
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1H-azepine;stilbene.
Molecular Properties
| Compound Name | 1H-azepine;stilbene |
| PubChem CID | 174433083 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1H-azepine;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.C1=CC=CNC=C1 |
| InChI | InChI=1S/C14H12.C6H7N/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-4-6-7-5-3-1/h1-12H;1-7H |
| InChIKey | ICHOHHPIMJBWJM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1H-azepine;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;stilbene?
The IUPAC name of 1H-azepine;stilbene (CID 174433083) is 1H-azepine;stilbene.
What is the SMILES notation for 1H-azepine;stilbene?
The canonical SMILES for 1H-azepine;stilbene is C(=Cc1ccccc1)c1ccccc1.C1=CC=CNC=C1.
What is the InChIKey of 1H-azepine;stilbene?
The InChIKey is ICHOHHPIMJBWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C6H7N/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-4-6-7-5-3-1/h1-12H;1-7H.
What are the key properties of 1H-azepine;stilbene?
1H-azepine;stilbene has a molecular weight of 273.38 g/mol, XLogP of 5.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;stilbene is sourced from PubChem (CID 174433083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).