C15H30N4O10 — CID 174439322
2-aminobutanedioic acid;6-amino-2-(hydroxyamino)hexanoic acid;4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 174439322) has the molecular formula C15H30N4O10 and a molecular weight of 426.42 g/mol. Its IUPAC name is 2-aminobutanedioic acid;6-amino-2-(hydroxyamino)hexanoic acid;4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 2-aminobutanedioic acid;6-amino-2-(hydroxyamino)hexanoic acid;4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174439322 |
| Molecular Formula | C15H30N4O10 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-aminobutanedioic acid;6-amino-2-(hydroxyamino)hexanoic acid;4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | NC(CC(=O)O)C(=O)O.NCCCCC(NO)C(=O)O.O=C(O)C1CC(O)CN1 |
| InChI | InChI=1S/C6H14N2O3.C5H9NO3.C4H7NO4/c7-4-2-1-3-5(8-11)6(9)10;7-3-1-4(5(8)9)6-2-3;5-2(4(8)9)1-3(6)7/h5,8,11H,1-4,7H2,(H,9,10);3-4,6-7H,1-2H2,(H,8,9);2H,1,5H2,(H,6,7)(H,8,9) |
| InChIKey | VUPPEQMPTNXIPN-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 265.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|