C16H12F2N2O — CID 174442573
6,7-difluoro-2-(1H-indol-3-yl)-1,3-dihydroindol-2-ol (PubChem CID 174442573) has the molecular formula C16H12F2N2O and a molecular weight of 286.28 g/mol. Its IUPAC name is 6,7-difluoro-2-(1H-indol-3-yl)-1,3-dihydroindol-2-ol.
| Compound Name | 6,7-difluoro-2-(1H-indol-3-yl)-1,3-dihydroindol-2-ol |
|---|---|
| PubChem CID | 174442573 |
| Molecular Formula | C16H12F2N2O |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 6,7-difluoro-2-(1H-indol-3-yl)-1,3-dihydroindol-2-ol |
| SMILES | OC1(c2c[nH]c3ccccc23)Cc2ccc(F)c(F)c2N1 |
| InChI | InChI=1S/C16H12F2N2O/c17-12-6-5-9-7-16(21,20-15(9)14(12)18)11-8-19-13-4-2-1-3-10(11)13/h1-6,8,19-21H,7H2 |
| InChIKey | OOODFBDSNYLACO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |