About 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole
3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole (PubChem CID 134948076) has the molecular formula C29H23N3
and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole.
Molecular Properties
| Compound Name | 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole |
| PubChem CID | 134948076 |
| Molecular Formula | C29H23N3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole |
| SMILES | c1ccc(C2=NN(c3ccccc3)C(c3ccccc3)(c3c[nH]c4ccccc34)C2)cc1 |
| InChI | InChI=1S/C29H23N3/c1-4-12-22(13-5-1)28-20-29(23-14-6-2-7-15-23,32(31-28)24-16-8-3-9-17-24)26-21-30-27-19-11-10-18-25(26)27/h1-19,21,30H,20H2 |
| InChIKey | OCJPCSCLOYLFBP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 31.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole?
The IUPAC name of 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole (CID 134948076) is 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole.
What is the SMILES notation for 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole?
The canonical SMILES for 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole is c1ccc(C2=NN(c3ccccc3)C(c3ccccc3)(c3c[nH]c4ccccc34)C2)cc1.
What is the InChIKey of 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole?
The InChIKey is OCJPCSCLOYLFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23N3/c1-4-12-22(13-5-1)28-20-29(23-14-6-2-7-15-23,32(31-28)24-16-8-3-9-17-24)26-21-30-27-19-11-10-18-25(26)27/h1-19,21,30H,20H2.
What are the key properties of 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole?
3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole has a molecular weight of 413.52 g/mol, XLogP of 6.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,5-triphenyl-4H-pyrazol-3-yl)-1H-indole is sourced from PubChem (CID 134948076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).