C17H18N2O2 — CID 72734788
[3-(hydroxymethyl)-2,5-diphenyl-4H-pyrazol-3-yl]methanol (PubChem CID 72734788) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2,5-diphenyl-4H-pyrazol-3-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-2,5-diphenyl-4H-pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 72734788 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [3-(hydroxymethyl)-2,5-diphenyl-4H-pyrazol-3-yl]methanol |
| SMILES | OCC1(CO)CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2/c20-12-17(13-21)11-16(14-7-3-1-4-8-14)18-19(17)15-9-5-2-6-10-15/h1-10,20-21H,11-13H2 |
| InChIKey | SJLHEHVMNXPJHR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |