C15H22O4 — CID 174442779
(1-methylcyclohexyl) 3-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate (PubChem CID 174442779) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1-methylcyclohexyl) 3-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate.
| Compound Name | (1-methylcyclohexyl) 3-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate |
|---|---|
| PubChem CID | 174442779 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1-methylcyclohexyl) 3-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate |
| SMILES | CC1(OC(=O)C2(C)CCC34OC3(C2)O4)CCCCC1 |
| InChI | InChI=1S/C15H22O4/c1-12(8-9-14-15(10-12,18-14)19-14)11(16)17-13(2)6-4-3-5-7-13/h3-10H2,1-2H3 |
| InChIKey | AJUHNFDRVLZABP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|